Showing entry for 2,2',4'-Trihydroxy-6'-Methoxy-3',5'-Dimethylchalcone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015369 |
| Compound Name | 2,2',4'-Trihydroxy-6'-Methoxy-3',5'-Dimethylchalcone |
| Structure | ![]() |
| Formula | C18H18O5 |
| InchiKey | SPWBEELZNSXNME-CMDGGOBGSA-N |
| SMILES | COc1c(C(=O)/C=C/c2ccccc2O)c(O)c(c(c1C)O)C |
| Inchi | InChI=1S/C18H18O5/c1-10-16(21)11(2)18(23-3)15(17(10)22)14(20)9-8-12-6-4-5-7-13(12)19/h4-9,19,21-22H,1-3H3/b9-8+ |
| IUPAC | (E)-1-(2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one |
| Molecular Weight | 314.12 |
| Pubchem Id | 11771403 |
| Chembl Id | CHEMBL509947 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL509947 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
