Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015518 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C32H44O7 |
| InchiKey | SYXKKJDQNXPUSI-QOIHGNKFSA-N |
| SMILES | CCCCC/C=C/C=C\C(=O)O[C@H]1C(=C[C@]23[C@]1(O)[C@H](O)C(=C[C@H](C3=O)[C@H]1[C@@H](C[C@H]2C)C1(C)C)COC(=O)C)C |
| Inchi | InChI=1S/C32H44O7/c1-7-8-9-10-11-12-13-14-25(34)39-29-19(2)17-31-20(3)15-24-26(30(24,5)6)23(28(31)36)16-22(18-38-21(4)33)27(35)32(29,31)37/h11-14,16-17,20,23-24,26-27,29,35,37H,7-10,15,18H2,1-6H3/b12-11+,14-13-/t20-,23+,24-,26+,27-,29+,31+,32+/m1/s1 |
| IUPAC | |
| Molecular Weight | 540.31 |
| Pubchem Id | 46882992 |
| Chembl Id | CHEMBL1078615 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1078615 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
