Showing entry for Epi Norgalanthamine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015754 |
| Compound Name | Epi Norgalanthamine |
| Structure | ![]() |
| Formula | C16H19NO3 |
| InchiKey | AIXQQSTVOSFSMO-FFSVYQOJSA-N |
| SMILES | COc1ccc2c3c1O[C@@H]1[C@@]3(CCNC2)C=C[C@H](C1)O |
| Inchi | InChI=1S/C16H19NO3/c1-19-12-3-2-10-9-17-7-6-16-5-4-11(18)8-13(16)20-15(12)14(10)16/h2-5,11,13,17-18H,6-9H2,1H3/t11-,13+,16+/m1/s1 |
| IUPAC | |
| Molecular Weight | 273.14 |
| Pubchem Id | 443721 |
| Chembl Id | CHEMBL3604339 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| Binding DB | 50116352 |
|
|||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3604339 |
|
|||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
