Showing entry for beta-Myrcene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015969 |
| Compound Name | beta-Myrcene |
| Structure | ![]() |
| Formula | C10H18 |
| InchiKey | MZPDTOMKQCMETI-BJMVGYQFSA-N |
| SMILES | C/C=C(/CCC=C(C)C)\C |
| Inchi | InChI=1S/C10H18/c1-5-10(4)8-6-7-9(2)3/h5,7H,6,8H2,1-4H3/b10-5+ |
| IUPAC | (6E)-2,6-dimethylocta-2,6-diene |
| Molecular Weight | 138.14 |
| Pubchem Id | 5365898 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | 650 |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
