Showing entry for colupulone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015978 |
| Compound Name | colupulone |
| Structure | ![]() |
| Formula | C25H36O4 |
| InchiKey | UNCDMWKTFLUPHZ-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(O)C(C(=O)C(=C1O)C(=O)C(C)C)(CC=C(C)C)CC=C(C)C)C |
| Inchi | InChI=1S/C25H36O4/c1-15(2)9-10-19-22(27)20(21(26)18(7)8)24(29)25(23(19)28,13-11-16(3)4)14-12-17(5)6/h9,11-12,18,27-28H,10,13-14H2,1-8H3 |
| IUPAC | 3,5-dihydroxy-4,6,6-tris(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
| Molecular Weight | 400.26 |
| Pubchem Id | 373677 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | CDZ |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
