Showing entry for Oliveroline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0015985 |
| Compound Name | Oliveroline |
| Structure | ![]() |
| Formula | C18H17NO3 |
| InchiKey | NVMGTUCOAQKLLO-IRXDYDNUSA-N |
| SMILES | CN1CCc2c3[C@H]1[C@@H](O)c1ccccc1c3c1c(c2)OCO1 |
| Inchi | InChI=1S/C18H17NO3/c1-19-7-6-10-8-13-18(22-9-21-13)15-11-4-2-3-5-12(11)17(20)16(19)14(10)15/h2-5,8,16-17,20H,6-7,9H2,1H3/t16-,17-/m0/s1 |
| IUPAC | |
| Molecular Weight | 295.12 |
| Pubchem Id | 12444634 |
| Chembl Id | CHEMBL221034 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL221034 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
