Showing entry for arabitol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016092 |
| Compound Name | arabitol |
| Structure | ![]() |
| Formula | C5H12O5 |
| InchiKey | HEBKCHPVOIAQTA-QWWZWVQMSA-N |
| SMILES | OC[C@H](C([C@@H](CO)O)O)O |
| Inchi | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m1/s1 |
| IUPAC | (2R,4R)-pentane-1,2,3,4,5-pentol |
| Molecular Weight | 152.07 |
| Pubchem Id | 94154 |
| Chembl Id | CHEMBL3186162 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3186162 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
