Showing entry for Perviridisinol A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016110 |
| Compound Name | Perviridisinol A |
| Structure | ![]() |
| Formula | C30H48O3 |
| InchiKey | VBULICPMWLGKQS-SCWKFBCUSA-N |
| SMILES | CC(=CC(=O)[C@H]([C@H]([C@H]1CC[C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H](C2(C)C)O)C)C)O)C |
| Inchi | InChI=1S/C30H48O3/c1-18(2)16-21(31)25(33)19(3)20-10-12-28(7)23-9-8-22-26(4,5)24(32)11-13-29(22)17-30(23,29)15-14-27(20,28)6/h16,19-20,22-25,32-33H,8-15,17H2,1-7H3/t19-,20+,22-,23-,24-,25-,27+,28-,29+,30-/m0/s1 |
| IUPAC | |
| Molecular Weight | 456.36 |
| Pubchem Id | 71658234 |
| Chembl Id | CHEMBL2331815 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2331815 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
