Showing entry for 2,3,10,11-Tetramethoxy-6,8,13,13A-Tetrahydro-5H-Isoquinolino[2,1-B]Isoquinoline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016221 |
| Compound Name | 2,3,10,11-Tetramethoxy-6,8,13,13A-Tetrahydro-5H-Isoquinolino[2,1-B]Isoquinoline |
| Structure | ![]() |
| Formula | C21H25NO4 |
| InchiKey | YOAUKNYXWBTMMF-UHFFFAOYSA-N |
| SMILES | COc1cc2CC3N(Cc2cc1OC)CCc1c3cc(OC)c(c1)OC |
| Inchi | InChI=1S/C21H25NO4/c1-23-18-8-13-5-6-22-12-15-10-20(25-3)19(24-2)9-14(15)7-17(22)16(13)11-21(18)26-4/h8-11,17H,5-7,12H2,1-4H3 |
| IUPAC | 2,3,10,11-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| Molecular Weight | 355.18 |
| Pubchem Id | 10653 |
| Chembl Id | CHEMBL2357282 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2357282 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
