Showing entry for Rauniticine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016258 |
| Compound Name | Rauniticine |
| Structure | ![]() |
| Formula | C21H24N2O3 |
| InchiKey | GRTOGORTSDXSFK-OYWVLEMYSA-N |
| SMILES | COC(=O)C1=CO[C@@H]([C@H]2[C@@H]1C[C@@H]1N(C2)CCc2c1[nH]c1c2cccc1)C |
| Inchi | InChI=1S/C21H24N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-6,11-12,15-16,19,22H,7-10H2,1-2H3/t12-,15+,16+,19+/m1/s1 |
| IUPAC | |
| Molecular Weight | 352.18 |
| Pubchem Id | 72338 |
| Chembl Id | CHEMBL486933 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL486933 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
