Showing entry for MENTHYL BENZOATE
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016270 |
| Compound Name | MENTHYL BENZOATE |
| Structure | ![]() |
| Formula | C17H24O2 |
| InchiKey | TTYVYRHNIVBWCB-VNQPRFMTSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)c1ccccc1)C(C)C |
| Inchi | InChI=1S/C17H24O2/c1-12(2)15-10-9-13(3)11-16(15)19-17(18)14-7-5-4-6-8-14/h4-8,12-13,15-16H,9-11H2,1-3H3/t13-,15+,16-/m1/s1 |
| IUPAC | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzoate |
| Molecular Weight | 260.18 |
| Pubchem Id | 170088 |
| Chembl Id | CHEMBL3039111 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3039111 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
