Showing entry for (3R)-2',3',7-trihydroxy-4'-methoxyisoflavan
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016315 |
| Compound Name | (3R)-2',3',7-trihydroxy-4'-methoxyisoflavan |
| Structure | ![]() |
| Formula | C16H16O5 |
| InchiKey | OPRVJOGZFPVPRP-JTQLQIEISA-N |
| SMILES | COc1ccc(c(c1O)O)[C@@H]1COc2c(C1)ccc(c2)O |
| Inchi | InChI=1S/C16H16O5/c1-20-13-5-4-12(15(18)16(13)19)10-6-9-2-3-11(17)7-14(9)21-8-10/h2-5,7,10,17-19H,6,8H2,1H3/t10-/m0/s1 |
| IUPAC | 3-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-6-methoxybenzene-1,2-diol |
| Molecular Weight | 288.1 |
| Pubchem Id | 15939757 |
| Chembl Id | CHEMBL592625 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL592625 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
