Showing entry for prostratin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016551 |
| Compound Name | prostratin |
| Structure | ![]() |
| Formula | C22H30O6 |
| InchiKey | BOJKFRKNLSCGHY-UHFFFAOYSA-N |
| SMILES | OCC1=CC2C3C(C3(C)C)(OC(=O)C)CC(C2(C2C(C1)(O)C(=O)C(=C2)C)O)C |
| Inchi | InChI=1S/C22H30O6/c1-11-6-16-20(26,18(11)25)9-14(10-23)7-15-17-19(4,5)21(17,28-13(3)24)8-12(2)22(15,16)27/h6-7,12,15-17,23,26-27H,8-10H2,1-5H3 |
| IUPAC | |
| Molecular Weight | 390.2 |
| Pubchem Id | 4962 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 86433 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
