Showing entry for Neral nitrile
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016773 |
| Compound Name | Neral nitrile |
| Structure | ![]() |
| Formula | C10H15N |
| InchiKey | HLCSDJLATUNSSI-YFHOEESVSA-N |
| SMILES | N#C/C=C(\CCC=C(C)C)/C |
| Inchi | InChI=1S/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6H2,1-3H3/b10-7- |
| IUPAC | (2Z)-3,7-dimethylocta-2,6-dienenitrile |
| Molecular Weight | 149.12 |
| Pubchem Id | 1551245 |
| Chembl Id | CHEMBL3188973 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | CTV |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3188973 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
