Showing entry for Phaeocaulisin F
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0016988 |
| Compound Name | Phaeocaulisin F |
| Structure | ![]() |
| Formula | C15H22O3 |
| InchiKey | RXDNOEVQPBWPMH-WHOFXGATSA-N |
| SMILES | OCC1=CC(=O)C(=C(C)C)C[C@H]2[C@H]1CC[C@]2(C)O |
| Inchi | InChI=1S/C15H22O3/c1-9(2)12-7-13-11(4-5-15(13,3)18)10(8-16)6-14(12)17/h6,11,13,16,18H,4-5,7-8H2,1-3H3/t11-,13-,15-/m0/s1 |
| IUPAC | (3S,3aS,8aR)-3-hydroxy-8-(hydroxymethyl)-3-methyl-5-propan-2-ylidene-2,3a,4,8a-tetrahydro-1H-azulen-6-one |
| Molecular Weight | 250.16 |
| Pubchem Id | 71578717 |
| Chembl Id | CHEMBL2332421 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2332421 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
