Showing entry for Marchantin C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017079 |
| Compound Name | Marchantin C |
| Structure | ![]() |
| Formula | C28H24O4 |
| InchiKey | BLRFPCOIKKIKNC-UHFFFAOYSA-N |
| SMILES | Oc1ccc2cc1Oc1ccc(cc1)CCc1c(Oc3cc(CC2)ccc3)c(O)ccc1 |
| Inchi | InChI=1S/C28H24O4/c29-25-16-12-21-8-7-20-3-1-5-24(17-20)32-28-22(4-2-6-26(28)30)13-9-19-10-14-23(15-11-19)31-27(25)18-21/h1-6,10-12,14-18,29-30H,7-9,13H2 |
| IUPAC | |
| Molecular Weight | 424.17 |
| Pubchem Id | 5319272 |
| Chembl Id | CHEMBL1243029 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1243029 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
