Showing entry for yibeinoside B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017539 |
| Compound Name | yibeinoside B |
| Structure | ![]() |
| Formula | C33H53NO7 |
| InchiKey | BSSXNTZKMOAXRA-MXXYQIINSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2)C(=O)C[C@@H]2[C@@H]3C[C@@H]3[C@H]2CC[C@@H]2[C@H]3CN3C[C@@H](C)CC[C@H]3[C@@H]2C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C33H53NO7/c1-16-4-7-26-17(2)19-5-6-20-21(23(19)14-34(26)13-16)11-24-22(20)12-27(36)25-10-18(8-9-33(24,25)3)40-32-31(39)30(38)29(37)28(15-35)41-32/h16-26,28-32,35,37-39H,4-15H2,1-3H3/t16-,17+,18-,19-,20+,21+,22-,23+,24-,25+,26-,28+,29+,30-,31+,32+ |
| IUPAC | |
| Molecular Weight | 575.38 |
| Pubchem Id | 192465 |
| Chembl Id | CHEMBL4129894 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4129894 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
