Showing entry for Lusianthridin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017595 |
| Compound Name | Lusianthridin |
| Structure | ![]() |
| Formula | C15H14O3 |
| InchiKey | RDKDIPDDUFMMMT-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1)CCc1c2ccc(c1)O |
| Inchi | InChI=1S/C15H14O3/c1-18-12-7-10-3-2-9-6-11(16)4-5-13(9)15(10)14(17)8-12/h4-8,16-17H,2-3H2,1H3 |
| IUPAC | 7-methoxy-9,10-dihydrophenanthrene-2,5-diol |
| Molecular Weight | 242.09 |
| Pubchem Id | 442702 |
| Chembl Id | CHEMBL254187 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 246496 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL254187 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
