Showing entry for Stemofoline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017636 |
| Compound Name | Stemofoline |
| Structure | ![]() |
| Formula | C22H29NO5 |
| InchiKey | DTVYAHOULQCSMS-JQANZLKUSA-N |
| SMILES | CCCC[C@]12[C@H]3C[C@@H]4N1CCC2[C@]1(O3)[C@@H]4[C@@H](/C(=C\2/OC(=O)C(=C2OC)C)/O1)C |
| Inchi | InChI=1S/C22H29NO5/c1-5-6-8-21-14-7-9-23(21)13-10-15(21)27-22(14)16(13)11(2)18(28-22)19-17(25-4)12(3)20(24)26-19/h11,13-16H,5-10H2,1-4H3/b19-18-/t11-,13-,14?,15+,16+,21-,22+/m0/s1 |
| IUPAC | |
| Molecular Weight | 387.2 |
| Pubchem Id | 44448167 |
| Chembl Id | CHEMBL2304257 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2304257 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
