Showing entry for 11(13)-dehydroivaxillin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017655 |
| Compound Name | 11(13)-dehydroivaxillin |
| Structure | ![]() |
| Formula | C15H20O4 |
| InchiKey | SSZZFAJCDFWCJW-JCJKHTMNSA-N |
| SMILES | O=C1O[C@@H]2[C@@H](C1=C)C[C@H]1O[C@]1(C)CC[C@@H]1[C@](C2)(C)O1 |
| Inchi | InChI=1S/C15H20O4/c1-8-9-6-12-14(2,19-12)5-4-11-15(3,18-11)7-10(9)17-13(8)16/h9-12H,1,4-7H2,2-3H3/t9-,10+,11-,12-,14-,15-/m1/s1 |
| IUPAC | |
| Molecular Weight | 264.14 |
| Pubchem Id | 13817982 |
| Chembl Id | CHEMBL3623293 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3623293 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
