Showing entry for 5,5'-Dipropylbiphenyl-2,2'-Diol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017697 |
| Compound Name | 5,5'-Dipropylbiphenyl-2,2'-Diol |
| Structure | ![]() |
| Formula | C18H22O2 |
| InchiKey | OYAQUBKYAKSHOA-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(c(c1)c1cc(CCC)ccc1O)O |
| Inchi | InChI=1S/C18H22O2/c1-3-5-13-7-9-17(19)15(11-13)16-12-14(6-4-2)8-10-18(16)20/h7-12,19-20H,3-6H2,1-2H3 |
| IUPAC | 2-(2-hydroxy-5-propylphenyl)-4-propylphenol |
| Molecular Weight | 270.16 |
| Pubchem Id | 5321851 |
| Chembl Id | CHEMBL32362 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50428092 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL32362 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
