Showing entry for Rabdocoetsin D
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017747 |
| Compound Name | Rabdocoetsin D |
| Structure | ![]() |
| Formula | C22H30O6 |
| InchiKey | XOKJELIQVHCONO-FDHBPYDESA-N |
| SMILES | CC(=O)O[C@H]1C[C@@H]2C[C@]3([C@@H]1[C@]14CO[C@]3(C[C@@H]4C(CC[C@@H]1O)(C)C)O)C(=O)C2=C |
| Inchi | InChI=1S/C22H30O6/c1-11-13-7-14(28-12(2)23)17-20-10-27-22(26,21(17,8-13)18(11)25)9-15(20)19(3,4)6-5-16(20)24/h13-17,24,26H,1,5-10H2,2-4H3/t13-,14+,15-,16+,17+,20+,21+,22+/m1/s1 |
| IUPAC | |
| Molecular Weight | 390.2 |
| Pubchem Id | 44559706 |
| Chembl Id | CHEMBL460858 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL460858 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
