Showing entry for picrasidine N
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0017963 |
| Compound Name | picrasidine N |
| Structure | ![]() |
| Formula | C29H22N4O4 |
| InchiKey | HHWIEEOARTXHMA-UHFFFAOYSA-N |
| SMILES | COn1c2c(ncc(c2c2c1cccc2)OC)CCn1ccc2c3c1cc(=O)c(=O)n3c1c2cccc1 |
| Inchi | InChI=1S/C29H22N4O4/c1-36-25-16-30-20(28-26(25)19-8-4-6-10-22(19)33(28)37-2)12-14-31-13-11-18-17-7-3-5-9-21(17)32-27(18)23(31)15-24(34)29(32)35/h3-11,13,15-16H,12,14H2,1-2H3 |
| IUPAC | |
| Molecular Weight | 490.16 |
| Pubchem Id | 5320557 |
| Chembl Id | CHEMBL3401864 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3401864 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
