Showing entry for 3,5-DIMETHOXYBENZOIC ACID
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0018513 |
| Compound Name | 3,5-DIMETHOXYBENZOIC ACID |
| Structure | ![]() |
| Formula | C9H10O4 |
| InchiKey | IWPZKOJSYQZABD-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(c1)C(=O)O |
| Inchi | InChI=1S/C9H10O4/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3,(H,10,11) |
| IUPAC | 3,5-dimethoxybenzoic acid |
| Molecular Weight | 182.06 |
| Pubchem Id | 14332 |
| Chembl Id | CHEMBL488610 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL488610 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
