Showing entry for uncarinic acid A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0018516 |
| Compound Name | uncarinic acid A |
| Structure | ![]() |
| Formula | C40H56O7 |
| InchiKey | HIFZHAYMNQEZKV-YFMQWVBVSA-N |
| SMILES | COc1cc(/C=C\C(=O)OC[C@@]23CC[C@@]4([C@H](C2=CC[C@H]2[C@@]3(C)CC[C@@H]3[C@]2(C)CC[C@@H](C3(C)C)O)CC(CC4)(C)C)C(=O)O)ccc1O |
| Inchi | InChI=1S/C40H56O7/c1-35(2)18-19-39(34(44)45)20-21-40(24-47-33(43)13-9-25-8-11-28(41)29(22-25)46-7)26(27(39)23-35)10-12-31-37(5)16-15-32(42)36(3,4)30(37)14-17-38(31,40)6/h8-11,13,22,27,30-32,41-42H,12,14-21,23-24H2,1-7H3,(H,44,45)/b13-9-/t27-,30-,31+,32-,3 |
| IUPAC | (4aS,6aR,6aR,6bR,8aR,10S,12aR,14bS)-10-hydroxy-6a-[[(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| Molecular Weight | 648.4 |
| Pubchem Id | 100967916 |
| Chembl Id | CHEMBL4073121 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4073121 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
