Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0018616 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C29H38O6 |
| InchiKey | MUWUPVKLPASBSZ-AWZHKKSRSA-N |
| SMILES | O=C(O[C@H]1[C@@H](C)C[C@]2([C@H]1[C@@H](O)[C@]1(C)CC[C@H]3[C@@H]([C@H]([C@@]1(C2=O)C)O)C3(C)C)O)/C=C/c1ccccc1 |
| Inchi | InChI=1S/C29H38O6/c1-16-15-29(34)21(22(16)35-19(30)12-11-17-9-7-6-8-10-17)23(31)27(4)14-13-18-20(26(18,2)3)24(32)28(27,5)25(29)33/h6-12,16,18,20-24,31-32,34H,13-15H2,1-5H3/b12-11+/t16-,18-,20-,21+,22-,23+,24+,27-,28+,29+/m0/s1 |
| IUPAC | |
| Molecular Weight | 482.27 |
| Pubchem Id | 73351973 |
| Chembl Id | CHEMBL2385086 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2385086 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
