Showing entry for (3S)-6,7-Dimethoxy-3-(6-Methyl-7,8-Dihydro-5H-[1,3]Dioxolo[4,5-G]Isoquinolin-5-Yl)-3H-2-Benzofuran-1-One
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0018663 |
| Compound Name | (3S)-6,7-Dimethoxy-3-(6-Methyl-7,8-Dihydro-5H-[1,3]Dioxolo[4,5-G]Isoquinolin-5-Yl)-3H-2-Benzofuran-1-One |
| Structure | ![]() |
| Formula | C21H21NO6 |
| InchiKey | JZUTXVTYJDCMDU-GGYWPGCISA-N |
| SMILES | COc1c(OC)ccc2c1C(=O)O[C@@H]2C1N(C)CCc2c1cc1OCOc1c2 |
| Inchi | InChI=1S/C21H21NO6/c1-22-7-6-11-8-15-16(27-10-26-15)9-13(11)18(22)19-12-4-5-14(24-2)20(25-3)17(12)21(23)28-19/h4-5,8-9,18-19H,6-7,10H2,1-3H3/t18?,19-/m0/s1 |
| IUPAC | (3S)-6,7-dimethoxy-3-(6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-2-benzofuran-1-one |
| Molecular Weight | 383.14 |
| Pubchem Id | 371942 |
| Chembl Id | CHEMBL462731 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL462731 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
