Showing entry for Rabdocoetsin C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0018680 |
| Compound Name | Rabdocoetsin C |
| Structure | ![]() |
| Formula | C20H28O5 |
| InchiKey | LHWIBAFYDZHDSL-TXWJGPDJSA-N |
| SMILES | O[C@H]1C[C@@H]2C[C@]3([C@@H]1[C@]14CO[C@]3(C[C@@H]4C(CC[C@@H]1O)(C)C)O)C(=O)C2=C |
| Inchi | InChI=1S/C20H28O5/c1-10-11-6-12(21)15-18-9-25-20(24,19(15,7-11)16(10)23)8-13(18)17(2,3)5-4-14(18)22/h11-15,21-22,24H,1,4-9H2,2-3H3/t11-,12+,13-,14+,15+,18+,19+,20+/m1/s1 |
| IUPAC | |
| Molecular Weight | 348.19 |
| Pubchem Id | 44559705 |
| Chembl Id | CHEMBL517266 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL517266 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
