Showing entry for 8-demethylmaritidine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0018789 |
| Compound Name | 8-demethylmaritidine |
| Structure | ![]() |
| Formula | C16H19NO3 |
| InchiKey | TZTBAJFJEZRQCV-RLCCDNCMSA-N |
| SMILES | COc1cc2c(cc1O)CN1[C@@H]3[C@@]2(C=C[C@H](C3)O)CC1 |
| Inchi | InChI=1S/C16H19NO3/c1-20-14-8-12-10(6-13(14)19)9-17-5-4-16(12)3-2-11(18)7-15(16)17/h2-3,6,8,11,15,18-19H,4-5,7,9H2,1H3/t11-,15+,16+/m1/s1 |
| IUPAC | |
| Molecular Weight | 273.14 |
| Pubchem Id | 443683 |
| Chembl Id | CHEMBL2087242 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50092611 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2087242 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
