Showing entry for NMVT
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0018912 |
| Compound Name | NMVT |
| Structure | ![]() |
| Formula | C17H25N3O2 |
| InchiKey | OQYFURUBPANIIX-BBRMVZONSA-N |
| SMILES | OC[C@H](Cc1c[nH]c2c1cccc2)N=C([C@H](C(C)C)NC)O |
| Inchi | InChI=1S/C17H25N3O2/c1-11(2)16(18-3)17(22)20-13(10-21)8-12-9-19-15-7-5-4-6-14(12)15/h4-7,9,11,13,16,18-19,21H,8,10H2,1-3H3,(H,20,22)/t13-,16-/m0/s1 |
| IUPAC | (2S)-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-3-methyl-2-(methylamino)butanamide |
| Molecular Weight | 303.19 |
| Pubchem Id | 91115345 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | B9R |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
