Showing entry for Evelynin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0019672 |
| Compound Name | Evelynin |
| Structure | ![]() |
| Formula | C19H20O7 |
| InchiKey | RESAUZHVVYGGHO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=O)C(=C(C1=O)OC)CCC(=O)c1ccc(c(c1)OC)OC |
| Inchi | InChI=1S/C19H20O7/c1-23-15-8-5-11(9-16(15)24-2)13(20)7-6-12-14(21)10-17(25-3)18(22)19(12)26-4/h5,8-10H,6-7H2,1-4H3 |
| IUPAC | 2-[3-(3,4-dimethoxyphenyl)-3-oxopropyl]-3,5-dimethoxycyclohexa-2,5-diene-1,4-dione |
| Molecular Weight | 360.12 |
| Pubchem Id | 46938776 |
| Chembl Id | CHEMBL1224594 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1224594 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
