Showing entry for cis-3-Methylcyclohexanol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0019870 |
| Compound Name | cis-3-Methylcyclohexanol |
| Structure | ![]() |
| Formula | C7H14O |
| InchiKey | HTSABYAWKQAHBT-NKWVEPMBSA-N |
| SMILES | C[C@H]1CCC[C@H](C1)O |
| Inchi | InChI=1S/C7H14O/c1-6-3-2-4-7(8)5-6/h6-8H,2-5H2,1H3/t6-,7+/m0/s1 |
| IUPAC | (1R,3S)-3-methylcyclohexan-1-ol |
| Molecular Weight | 114.1 |
| Pubchem Id | 21599 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | VF4 |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
