Showing entry for Dodecyl Gallate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0020139 |
| Compound Name | Dodecyl Gallate |
| Structure | ![]() |
| Formula | C19H30O5 |
| InchiKey | RPWFJAMTCNSJKK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCOC(=O)c1cc(O)c(c(c1)O)O |
| Inchi | InChI=1S/C19H30O5/c1-2-3-4-5-6-7-8-9-10-11-12-24-19(23)15-13-16(20)18(22)17(21)14-15/h13-14,20-22H,2-12H2,1H3 |
| IUPAC | dodecyl 3,4,5-trihydroxybenzoate |
| Molecular Weight | 338.21 |
| Pubchem Id | 14425 |
| Chembl Id | CHEMBL16121 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50093887 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL16121 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
