Showing entry for 4,6-Diene-1beta,14-dihydroxyeudesma-3-one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0020325 |
| Compound Name | 4,6-Diene-1beta,14-dihydroxyeudesma-3-one |
| Structure | ![]() |
| Formula | C15H22O3 |
| InchiKey | ARYHWGXGRJYLNK-HUUCEWRRSA-N |
| SMILES | OCC1=C2C=C(CC[C@]2([C@@H](CC1=O)O)C)C(C)C |
| Inchi | InChI=1S/C15H22O3/c1-9(2)10-4-5-15(3)12(6-10)11(8-16)13(17)7-14(15)18/h6,9,14,16,18H,4-5,7-8H2,1-3H3/t14-,15-/m1/s1 |
| IUPAC | |
| Molecular Weight | 250.16 |
| Pubchem Id | 50901153 |
| Chembl Id | CHEMBL1651035 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50335582 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1651035 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
