Showing entry for veratryl alcohol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0020359 |
| Compound Name | veratryl alcohol |
| Structure | ![]() |
| Formula | C9H12O3 |
| InchiKey | OEGPRYNGFWGMMV-UHFFFAOYSA-N |
| SMILES | COc1cc(CO)ccc1OC |
| Inchi | InChI=1S/C9H12O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5,10H,6H2,1-2H3 |
| IUPAC | (3,4-dimethoxyphenyl)methanol |
| Molecular Weight | 168.08 |
| Pubchem Id | 7118 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | VOH |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
