Showing entry for Corytuberine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0020378 |
| Compound Name | Corytuberine |
| Structure | ![]() |
| Formula | C19H21NO4 |
| InchiKey | WHFUDAOCYRYAKQ-LBPRGKRZSA-N |
| SMILES | COc1ccc2c(c1O)c1c(O)c(OC)cc3c1[C@H](C2)N(C)CC3 |
| Inchi | InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(24-3)19(22)17-15(11)12(20)8-10-4-5-13(23-2)18(21)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3/t12-/m0/s1 |
| IUPAC | (6aS)-2,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,11-diol |
| Molecular Weight | 327.15 |
| Pubchem Id | 160500 |
| Chembl Id | CHEMBL227965 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50197838 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL227965 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
