Showing entry for Combretanone G
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0020617 |
| Compound Name | Combretanone G |
| Structure | ![]() |
| Formula | C31H50O3 |
| InchiKey | PSQJXRKLAZZNHC-OLKLHFONSA-N |
| SMILES | COC(/C=C/C[C@H]([C@H]1CC[C@@]2([C@]1(C)CC[C@@]13[C@H]2[C@@H](O)C[C@@H]2[C@]3(C1)CCC(=O)C2(C)C)C)C)(C)C |
| Inchi | InChI=1S/C31H50O3/c1-20(10-9-13-26(2,3)34-8)21-11-14-29(7)25-22(32)18-23-27(4,5)24(33)12-15-30(23)19-31(25,30)17-16-28(21,29)6/h9,13,20-23,25,32H,10-12,14-19H2,1-8H3/b13-9+/t20-,21-,22+,23+,25+,28-,29+,30-,31+/m1/s1 |
| IUPAC | |
| Molecular Weight | 470.38 |
| Pubchem Id | 51041526 |
| Chembl Id | CHEMBL1689266 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1689266 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
