Showing entry for eurycarpin A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0020759 |
| Compound Name | eurycarpin A |
| Structure | ![]() |
| Formula | C20H18O5 |
| InchiKey | NNCFAUGCNTZUIW-UHFFFAOYSA-N |
| SMILES | CC(=CCc1c(O)ccc(c1O)c1coc2c(c1=O)ccc(c2)O)C |
| Inchi | InChI=1S/C20H18O5/c1-11(2)3-5-14-17(22)8-7-13(19(14)23)16-10-25-18-9-12(21)4-6-15(18)20(16)24/h3-4,6-10,21-23H,5H2,1-2H3 |
| IUPAC | 3-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-7-hydroxychromen-4-one |
| Molecular Weight | 338.12 |
| Pubchem Id | 5317300 |
| Chembl Id | CHEMBL4065779 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4065779 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
