Showing entry for Paspaline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0021320 |
| Compound Name | Paspaline |
| Structure | ![]() |
| Formula | C28H39NO2 |
| InchiKey | WLAIEIMDXUAGPY-HSECPPETSA-N |
| SMILES | CC([C@@H]1CC[C@@]2([C@@H](O1)CC[C@]1([C@H]2CC[C@@H]2[C@]1(C)c1[nH]c3c(c1C2)cccc3)C)C)(O)C |
| Inchi | InChI=1S/C28H39NO2/c1-25(2,30)22-12-14-26(3)21-11-10-17-16-19-18-8-6-7-9-20(18)29-24(19)28(17,5)27(21,4)15-13-23(26)31-22/h6-9,17,21-23,29-30H,10-16H2,1-5H3/t17-,21-,22-,23-,26-,27-,28+/m0/s1 |
| IUPAC | |
| Molecular Weight | 421.3 |
| Pubchem Id | 115028 |
| Chembl Id | CHEMBL2408947 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2408947 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
