Showing entry for (Z,Z)-5-(Trideca-4,7-Dienyl)-Resorcinol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0021550 |
| Compound Name | (Z,Z)-5-(Trideca-4,7-Dienyl)-Resorcinol |
| Structure | ![]() |
| Formula | C19H28O2 |
| InchiKey | DWGFCVWXMWMPHS-HZJYTTRNSA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCc1cc(O)cc(c1)O |
| Inchi | InChI=1S/C19H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-14-18(20)16-19(21)15-17/h6-7,9-10,14-16,20-21H,2-5,8,11-13H2,1H3/b7-6-,10-9- |
| IUPAC | 5-[(4Z,7Z)-trideca-4,7-dienyl]benzene-1,3-diol |
| Molecular Weight | 288.21 |
| Pubchem Id | 643751 |
| Chembl Id | CHEMBL2147166 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2147166 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
