Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0021669 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C28H38O6 |
| InchiKey | MEXBEYZBKLMZMO-HSDYZQCMSA-N |
| SMILES | CO[C@@H]1[C@@H]2[C@@H](C2(C)C)CC[C@@]2([C@@]1(C)C(=O)[C@]1(C[C@@H]([C@@H]([C@@H]1[C@H]2O)O)C)OC(=O)c1ccccc1)C |
| Inchi | InChI=1S/C28H38O6/c1-15-14-28(34-23(31)16-10-8-7-9-11-16)19(20(15)29)21(30)26(4)13-12-17-18(25(17,2)3)22(33-6)27(26,5)24(28)32/h7-11,15,17-22,29-30H,12-14H2,1-6H3/t15-,17-,18-,19+,20-,21+,22+,26-,27+,28+/m0/s1 |
| IUPAC | |
| Molecular Weight | 470.27 |
| Pubchem Id | 73348880 |
| Chembl Id | CHEMBL2385642 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2385642 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
