Showing entry for (2S,3R)-2-azaniumyl-3-hydroxy-4-methylpentanoate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0021740 |
| Compound Name | (2S,3R)-2-azaniumyl-3-hydroxy-4-methylpentanoate |
| Structure | ![]() |
| Formula | C6H13NO3 |
| InchiKey | ZAYJDMWJYCTABM-CRCLSJGQSA-N |
| SMILES | CC([C@H]([C@@H](C(=O)O)N)O)C |
| Inchi | InChI=1S/C6H13NO3/c1-3(2)5(8)4(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10)/t4-,5+/m0/s1 |
| IUPAC | (2S,3R)-2-amino-3-hydroxy-4-methylpentanoic acid |
| Molecular Weight | 147.09 |
| Pubchem Id | 6994742 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | HL2 |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
