Showing entry for 4,5-Dimethoxycanthin-6-One
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0021844 |
| Compound Name | 4,5-Dimethoxycanthin-6-One |
| Structure | ![]() |
| Formula | C16H12N2O3 |
| InchiKey | ATONBUGCNDSBBC-UHFFFAOYSA-N |
| SMILES | COc1c(OC)c2nccc3c2n(c1=O)c1ccccc31 |
| Inchi | InChI=1S/C16H12N2O3/c1-20-14-12-13-10(7-8-17-12)9-5-3-4-6-11(9)18(13)16(19)15(14)21-2/h3-8H,1-2H3 |
| IUPAC | |
| Molecular Weight | 280.08 |
| Pubchem Id | 638215 |
| Chembl Id | CHEMBL2386324 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2386324 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
