Showing entry for (R)-Lasiodiplodin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022078 |
| Compound Name | (R)-Lasiodiplodin |
| Structure | ![]() |
| Formula | C17H24O4 |
| InchiKey | OKWRDLQBKAOJNC-GFCCVEGCSA-N |
| SMILES | COc1cc(O)cc2c1C(=O)O[C@H](C)CCCCCCC2 |
| Inchi | InChI=1S/C17H24O4/c1-12-8-6-4-3-5-7-9-13-10-14(18)11-15(20-2)16(13)17(19)21-12/h10-12,18H,3-9H2,1-2H3/t12-/m1/s1 |
| IUPAC | (9R)-15-hydroxy-13-methoxy-9-methyl-10-oxabicyclo[10.4.0]hexadeca-1(16),12,14-trien-11-one |
| Molecular Weight | 292.17 |
| Pubchem Id | 11833217 |
| Chembl Id | CHEMBL1669748 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1669748 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
