Showing entry for d-Alaninol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022111 |
| Compound Name | d-Alaninol |
| Structure | ![]() |
| Formula | C3H9NO |
| InchiKey | BKMMTJMQCTUHRP-GSVOUGTGSA-N |
| SMILES | C[C@H](CO)N |
| Inchi | InChI=1S/C3H9NO/c1-3(4)2-5/h3,5H,2,4H2,1H3/t3-/m1/s1 |
| IUPAC | (2R)-2-aminopropan-1-ol |
| Molecular Weight | 75.07 |
| Pubchem Id | 80308 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | 2A3 |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
