Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022200 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C28H36O10 |
| InchiKey | NQEPRIPSHBTYJA-BAENWPLBSA-N |
| SMILES | CC(=O)OC[C@@]12[C@@H](OC(=O)c3ccccc3)C[C@@H]3[C@H]([C@]2(OC3(C)C)[C@@](CC[C@@H]1OC(=O)C)(C)O)OC(=O)C |
| Inchi | InChI=1S/C28H36O10/c1-16(29)34-15-27-21(35-17(2)30)12-13-26(6,33)28(27)23(36-18(3)31)20(25(4,5)38-28)14-22(27)37-24(32)19-10-8-7-9-11-19/h7-11,20-23,33H,12-15H2,1-6H3/t20-,21+,22+,23-,26+,27+,28+/m1/s1 |
| IUPAC | |
| Molecular Weight | 532.23 |
| Pubchem Id | 23252572 |
| Chembl Id | CHEMBL3577223 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3577223 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
