Showing entry for Aristolochic Acid C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022301 |
| Compound Name | Aristolochic Acid C |
| Structure | ![]() |
| Formula | C16H9NO7 |
| InchiKey | NBFGYDJKTHENDP-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)c1c3OCOc3cc(c1c(c2)N(=O)=O)C(=O)O |
| Inchi | InChI=1S/C16H9NO7/c18-8-2-1-7-3-11(17(21)22)13-10(16(19)20)5-12-15(24-6-23-12)14(13)9(7)4-8/h1-5,18H,6H2,(H,19,20) |
| IUPAC | 10-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
| Molecular Weight | 327.04 |
| Pubchem Id | 165274 |
| Chembl Id | CHEMBL603494 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50306858 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL603494 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
