Showing entry for 2-Ethylbenzylalcohol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022457 |
| Compound Name | 2-Ethylbenzylalcohol |
| Structure | ![]() |
| Formula | C9H12O |
| InchiKey | SBUIQTMDIOLKAL-UHFFFAOYSA-N |
| SMILES | OCc1ccccc1CC |
| Inchi | InChI=1S/C9H12O/c1-2-8-5-3-4-6-9(8)7-10/h3-6,10H,2,7H2,1H3 |
| IUPAC | (2-ethylphenyl)methanol |
| Molecular Weight | 136.09 |
| Pubchem Id | 5225083 |
| Chembl Id | CHEMBL386156 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | 12M |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL386156 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
