Showing entry for LICOAGROCARPIN
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022526 |
| Compound Name | LICOAGROCARPIN |
| Structure | ![]() |
| Formula | C21H22O4 |
| InchiKey | NYWUHXBEDBSRQB-UWJYYQICSA-N |
| SMILES | COc1ccc2c(c1)O[C@@H]1[C@H]2COc2c1ccc(c2CC=C(C)C)O |
| Inchi | InChI=1S/C21H22O4/c1-12(2)4-6-15-18(22)9-8-16-20(15)24-11-17-14-7-5-13(23-3)10-19(14)25-21(16)17/h4-5,7-10,17,21-22H,6,11H2,1-3H3/t17-,21-/m0/s1 |
| IUPAC | (6aR,11aR)-9-methoxy-4-(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol |
| Molecular Weight | 338.15 |
| Pubchem Id | 15840593 |
| Chembl Id | CHEMBL2437361 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2437361 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
