Showing entry for Gamma-Rubromycin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022683 |
| Compound Name | Gamma-Rubromycin |
| Structure | ![]() |
| Formula | C26H18O12 |
| InchiKey | CKLKRRFSZZUFKT-SANMLTNESA-N |
| SMILES | COC(=O)c1cc2cc3CC[C@@]4(Oc3c(c2c(=O)o1)O)Cc1c(O4)c(O)c2c(c1O)C(=O)C=C(C2=O)OC |
| Inchi | InChI=1S/C26H18O12/c1-34-13-7-12(27)16-17(19(13)29)21(31)23-11(18(16)28)8-26(38-23)4-3-9-5-10-6-14(24(32)35-2)36-25(33)15(10)20(30)22(9)37-26/h5-7,28,30-31H,3-4,8H2,1-2H3/t26-/m0/s1 |
| IUPAC | methyl (2S)-4',9',10-trihydroxy-7'-methoxy-5',8',9-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate |
| Molecular Weight | 522.08 |
| Pubchem Id | 5464075 |
| Chembl Id | CHEMBL3347482 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3347482 |
|
|||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
